C21H26FN3O4 — CID 9404952
N-[4-(4-fluoro-3-nitroanilino)-4-oxobutyl]adamantane-1-carboxamide (PubChem CID 9404952) has the molecular formula C21H26FN3O4 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[4-(4-fluoro-3-nitroanilino)-4-oxobutyl]adamantane-1-carboxamide.
| Compound Name | N-[4-(4-fluoro-3-nitroanilino)-4-oxobutyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9404952 |
| Molecular Formula | C21H26FN3O4 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[4-(4-fluoro-3-nitroanilino)-4-oxobutyl]adamantane-1-carboxamide |
| SMILES | O=C(CCCNC(=O)C12CC3CC(CC(C3)C1)C2)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26FN3O4/c22-17-4-3-16(9-18(17)25(28)29)24-19(26)2-1-5-23-20(27)21-10-13-6-14(11-21)8-15(7-13)12-21/h3-4,9,13-15H,1-2,5-8,10-12H2,(H,23,27)(H,24,26) |
| InChIKey | FFCDKVHIUMGYAM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|