C22H29ClN2O2 — CID 9398365
N-[4-(5-chloro-2-methylanilino)-4-oxobutyl]adamantane-1-carboxamide (PubChem CID 9398365) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is N-[4-(5-chloro-2-methylanilino)-4-oxobutyl]adamantane-1-carboxamide.
| Compound Name | N-[4-(5-chloro-2-methylanilino)-4-oxobutyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9398365 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[4-(5-chloro-2-methylanilino)-4-oxobutyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CCCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29ClN2O2/c1-14-4-5-18(23)10-19(14)25-20(26)3-2-6-24-21(27)22-11-15-7-16(12-22)9-17(8-15)13-22/h4-5,10,15-17H,2-3,6-9,11-13H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | DZPVFBMSBWTHGW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|