C24H32N2O4 — CID 8528825
[2-(2,5-dimethylanilino)-2-oxoethyl] 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 8528825) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8528825 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | Cc1ccc(C)c(NC(=O)COC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C24H32N2O4/c1-15-3-4-16(2)20(7-15)26-21(27)14-30-22(28)5-6-25-23(29)24-11-17-8-18(12-24)10-19(9-17)13-24/h3-4,7,17-19H,5-6,8-14H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | MITHUXIHQYETEG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |