C16H24N2O4 — CID 8528535
(2-amino-2-oxoethyl) 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 8528535) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | (2-amino-2-oxoethyl) 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8528535 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | NC(=O)COC(=O)CCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H24N2O4/c17-13(19)9-22-14(20)1-2-18-15(21)16-6-10-3-11(7-16)5-12(4-10)8-16/h10-12H,1-9H2,(H2,17,19)(H,18,21) |
| InChIKey | SYHQMEAVQFAZRA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |