C20H28N2O5 — CID 8528272
[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 8528272) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8528272 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)C12CC3CC(CC(C3)C1)C2)OCC(=O)N1CCCC1=O |
| InChI | InChI=1S/C20H28N2O5/c23-16-2-1-5-22(16)17(24)12-27-18(25)3-4-21-19(26)20-9-13-6-14(10-20)8-15(7-13)11-20/h13-15H,1-12H2,(H,21,26) |
| InChIKey | AMISTMNZUJBXOY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |