C21H26N2O5S — CID 8529028
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 8529028) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8529028 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | O=C(COC(=O)CCNC(=O)C12CC3CC(CC(C3)C1)C2)NC(=O)c1cccs1 |
| InChI | InChI=1S/C21H26N2O5S/c24-17(23-19(26)16-2-1-5-29-16)12-28-18(25)3-4-22-20(27)21-9-13-6-14(10-21)8-15(7-13)11-21/h1-2,5,13-15H,3-4,6-12H2,(H,22,27)(H,23,24,26) |
| InChIKey | XMIPDEXEDGENQH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |