C17H17FN2O4S — CID 35294378
[2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)propanoate (PubChem CID 35294378) has the molecular formula C17H17FN2O4S and a molecular weight of 364.40 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)propanoate.
| Compound Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 35294378 |
| Molecular Formula | C17H17FN2O4S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-(thiophene-2-carbonylamino)propanoate |
| SMILES | O=C(COC(=O)CCNC(=O)c1cccs1)NCc1ccccc1F |
| InChI | InChI=1S/C17H17FN2O4S/c18-13-5-2-1-4-12(13)10-20-15(21)11-24-16(22)7-8-19-17(23)14-6-3-9-25-14/h1-6,9H,7-8,10-11H2,(H,19,23)(H,20,21) |
| InChIKey | GCOUEEXDTFWOBU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |