C22H24N2O8S2 — CID 16540287
[2-oxo-2-[2-[[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]amino]ethylamino]ethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 16540287) has the molecular formula C22H24N2O8S2 and a molecular weight of 508.57 g/mol. Its IUPAC name is [2-oxo-2-[2-[[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]amino]ethylamino]ethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [2-oxo-2-[2-[[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]amino]ethylamino]ethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 16540287 |
| Molecular Formula | C22H24N2O8S2 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | [2-oxo-2-[2-[[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]amino]ethylamino]ethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1cccs1)NCCNC(=O)COC(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C22H24N2O8S2/c25-15(17-3-1-11-33-17)5-7-21(29)31-13-19(27)23-9-10-24-20(28)14-32-22(30)8-6-16(26)18-4-2-12-34-18/h1-4,11-12H,5-10,13-14H2,(H,23,27)(H,24,28) |
| InChIKey | GKRPMTUFTMFMBY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|