C20H21N3O6S — CID 47012037
[2-(2-carbamoylanilino)-2-oxoethyl] 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate (PubChem CID 47012037) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is [2-(2-carbamoylanilino)-2-oxoethyl] 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate.
| Compound Name | [2-(2-carbamoylanilino)-2-oxoethyl] 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 47012037 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [2-(2-carbamoylanilino)-2-oxoethyl] 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate |
| SMILES | NC(=O)c1ccccc1NC(=O)COC(=O)CCNC(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C20H21N3O6S/c21-20(28)13-4-1-2-5-14(13)23-18(26)12-29-19(27)9-10-22-17(25)8-7-15(24)16-6-3-11-30-16/h1-6,11H,7-10,12H2,(H2,21,28)(H,22,25)(H,23,26) |
| InChIKey | WTRJAMPNCCPKMF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |