C18H19NO4S2 — CID 7603730
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 7603730) has the molecular formula C18H19NO4S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7603730 |
| Molecular Formula | C18H19NO4S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1cccs1)NCCSc1ccccc1 |
| InChI | InChI=1S/C18H19NO4S2/c20-15(16-7-4-11-25-16)8-9-18(22)23-13-17(21)19-10-12-24-14-5-2-1-3-6-14/h1-7,11H,8-10,12-13H2,(H,19,21) |
| InChIKey | DCXNYTFZRVHGIH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|