C15H16N2O2S2 — CID 26444525
N-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]thiophene-2-carboxamide (PubChem CID 26444525) has the molecular formula C15H16N2O2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26444525 |
| Molecular Formula | C15H16N2O2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccs1)NCCSc1ccccc1 |
| InChI | InChI=1S/C15H16N2O2S2/c18-14(11-17-15(19)13-7-4-9-21-13)16-8-10-20-12-5-2-1-3-6-12/h1-7,9H,8,10-11H2,(H,16,18)(H,17,19) |
| InChIKey | XOGFYQHXRUVUGA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|