C20H18N2O2S2 — CID 9483103
N-[4-(2-phenylsulfanylethylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 9483103) has the molecular formula C20H18N2O2S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[4-(2-phenylsulfanylethylcarbamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(2-phenylsulfanylethylcarbamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9483103 |
| Molecular Formula | C20H18N2O2S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-[4-(2-phenylsulfanylethylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H18N2O2S2/c23-19(21-12-14-25-17-5-2-1-3-6-17)15-8-10-16(11-9-15)22-20(24)18-7-4-13-26-18/h1-11,13H,12,14H2,(H,21,23)(H,22,24) |
| InChIKey | XRDPGSYMVOWWKR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|