C20H18N4O4S — CID 9278900
N-[4-[2-(2-nitroanilino)ethylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 9278900) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is N-[4-[2-(2-nitroanilino)ethylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-(2-nitroanilino)ethylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9278900 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-[4-[2-(2-nitroanilino)ethylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCNc1ccccc1[N+](=O)[O-])c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H18N4O4S/c25-19(22-12-11-21-16-4-1-2-5-17(16)24(27)28)14-7-9-15(10-8-14)23-20(26)18-6-3-13-29-18/h1-10,13,21H,11-12H2,(H,22,25)(H,23,26) |
| InChIKey | HOVAHSAOUIZSFT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|