C11H7N3O5S — CID 86673965
N-(3,4-dinitrophenyl)thiophene-2-carboxamide (PubChem CID 86673965) has the molecular formula C11H7N3O5S and a molecular weight of 293.26 g/mol. Its IUPAC name is N-(3,4-dinitrophenyl)thiophene-2-carboxamide.
| Compound Name | N-(3,4-dinitrophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 86673965 |
| Molecular Formula | C11H7N3O5S |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | N-(3,4-dinitrophenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)c1cccs1 |
| InChI | InChI=1S/C11H7N3O5S/c15-11(10-2-1-5-20-10)12-7-3-4-8(13(16)17)9(6-7)14(18)19/h1-6H,(H,12,15) |
| InChIKey | WEUVWWOWCYGWIB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|