C12H11NO2S — CID 64794383
N-(3-hydroxy-4-methylphenyl)thiophene-2-carboxamide (PubChem CID 64794383) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is N-(3-hydroxy-4-methylphenyl)thiophene-2-carboxamide.
| Compound Name | N-(3-hydroxy-4-methylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 64794383 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | N-(3-hydroxy-4-methylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccs2)cc1O |
| InChI | InChI=1S/C12H11NO2S/c1-8-4-5-9(7-10(8)14)13-12(15)11-3-2-6-16-11/h2-7,14H,1H3,(H,13,15) |
| InChIKey | BXNPOYQQCKZYPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |