C20H16N2O4S — CID 1432969
2-[[2-methyl-5-(thiophene-2-carbonylamino)phenyl]carbamoyl]benzoic acid (PubChem CID 1432969) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-[[2-methyl-5-(thiophene-2-carbonylamino)phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[2-methyl-5-(thiophene-2-carbonylamino)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 1432969 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-[[2-methyl-5-(thiophene-2-carbonylamino)phenyl]carbamoyl]benzoic acid |
| SMILES | Cc1ccc(NC(=O)c2cccs2)cc1NC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C20H16N2O4S/c1-12-8-9-13(21-19(24)17-7-4-10-27-17)11-16(12)22-18(23)14-5-2-3-6-15(14)20(25)26/h2-11H,1H3,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | GEWTXRSTBSOCKZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |