C15H19NOS — CID 143815290
N-(2,5-dimethylphenyl)thiophene-2-carboxamide;ethane (PubChem CID 143815290) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)thiophene-2-carboxamide;ethane.
| Compound Name | N-(2,5-dimethylphenyl)thiophene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143815290 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-(2,5-dimethylphenyl)thiophene-2-carboxamide;ethane |
| SMILES | CC.Cc1ccc(C)c(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C13H13NOS.C2H6/c1-9-5-6-10(2)11(8-9)14-13(15)12-4-3-7-16-12;1-2/h3-8H,1-2H3,(H,14,15);1-2H3 |
| InChIKey | JSJGABNMTQJSPT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |