C17H14N2O2S2 — CID 838783
N-[4-methyl-3-(thiophene-2-carbonylamino)phenyl]thiophene-2-carboxamide (PubChem CID 838783) has the molecular formula C17H14N2O2S2 and a molecular weight of 342.45 g/mol. Its IUPAC name is N-[4-methyl-3-(thiophene-2-carbonylamino)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-methyl-3-(thiophene-2-carbonylamino)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 838783 |
| Molecular Formula | C17H14N2O2S2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-[4-methyl-3-(thiophene-2-carbonylamino)phenyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccs2)cc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C17H14N2O2S2/c1-11-6-7-12(18-16(20)14-4-2-8-22-14)10-13(11)19-17(21)15-5-3-9-23-15/h2-10H,1H3,(H,18,20)(H,19,21) |
| InChIKey | WXHSBBUFSHLCNH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |