C14H14N2O2S — CID 110866335
N-[(2,5-dimethylphenyl)carbamoyl]thiophene-2-carboxamide (PubChem CID 110866335) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)carbamoyl]thiophene-2-carboxamide.
| Compound Name | N-[(2,5-dimethylphenyl)carbamoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110866335 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-[(2,5-dimethylphenyl)carbamoyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C14H14N2O2S/c1-9-5-6-10(2)11(8-9)15-14(18)16-13(17)12-4-3-7-19-12/h3-8H,1-2H3,(H2,15,16,17,18) |
| InChIKey | UKBDMMLPDMRNIW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |