C21H19N5O2S — CID 23800699
N-[3-[3-(benzotriazol-1-yl)propanoylamino]-4-methylphenyl]thiophene-2-carboxamide (PubChem CID 23800699) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[3-[3-(benzotriazol-1-yl)propanoylamino]-4-methylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[3-(benzotriazol-1-yl)propanoylamino]-4-methylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23800699 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[3-[3-(benzotriazol-1-yl)propanoylamino]-4-methylphenyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccs2)cc1NC(=O)CCn1nnc2ccccc21 |
| InChI | InChI=1S/C21H19N5O2S/c1-14-8-9-15(22-21(28)19-7-4-12-29-19)13-17(14)23-20(27)10-11-26-18-6-3-2-5-16(18)24-25-26/h2-9,12-13H,10-11H2,1H3,(H,22,28)(H,23,27) |
| InChIKey | ZLGKZLFBUMFTHR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |