C19H15BrN2O3S — CID 1258183
N-[4-[(2-bromobenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide (PubChem CID 1258183) has the molecular formula C19H15BrN2O3S and a molecular weight of 431.31 g/mol. Its IUPAC name is N-[4-[(2-bromobenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(2-bromobenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1258183 |
| Molecular Formula | C19H15BrN2O3S |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | N-[4-[(2-bromobenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccccc2Br)ccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C19H15BrN2O3S/c1-25-16-11-12(21-18(23)13-5-2-3-6-14(13)20)8-9-15(16)22-19(24)17-7-4-10-26-17/h2-11H,1H3,(H,21,23)(H,22,24) |
| InChIKey | AAUBXTZVMOLOMK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |