C23H17BrN2O4S — CID 17117556
5-(4-bromophenyl)-N-[3-methoxy-4-(thiophene-2-carbonylamino)phenyl]furan-2-carboxamide (PubChem CID 17117556) has the molecular formula C23H17BrN2O4S and a molecular weight of 497.37 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[3-methoxy-4-(thiophene-2-carbonylamino)phenyl]furan-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-[3-methoxy-4-(thiophene-2-carbonylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17117556 |
| Molecular Formula | C23H17BrN2O4S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 5-(4-bromophenyl)-N-[3-methoxy-4-(thiophene-2-carbonylamino)phenyl]furan-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(-c3ccc(Br)cc3)o2)ccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C23H17BrN2O4S/c1-29-20-13-16(8-9-17(20)26-23(28)21-3-2-12-31-21)25-22(27)19-11-10-18(30-19)14-4-6-15(24)7-5-14/h2-13H,1H3,(H,25,27)(H,26,28) |
| InChIKey | VFCKUGYRPJYQCD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |