C15H17N3O3S — CID 92944479
N-[4-(3-aminopropanoylamino)-2-methoxyphenyl]thiophene-2-carboxamide (PubChem CID 92944479) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[4-(3-aminopropanoylamino)-2-methoxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(3-aminopropanoylamino)-2-methoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 92944479 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-[4-(3-aminopropanoylamino)-2-methoxyphenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(NC(=O)CCN)ccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C15H17N3O3S/c1-21-12-9-10(17-14(19)6-7-16)4-5-11(12)18-15(20)13-3-2-8-22-13/h2-5,8-9H,6-7,16H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | OELKFPDJNJFDHA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |