C24H26N2O4S — CID 22780919
N-[4-[[2-(4-butan-2-ylphenoxy)acetyl]amino]-2-methoxyphenyl]thiophene-2-carboxamide (PubChem CID 22780919) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[4-[[2-(4-butan-2-ylphenoxy)acetyl]amino]-2-methoxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[2-(4-butan-2-ylphenoxy)acetyl]amino]-2-methoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 22780919 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[4-[[2-(4-butan-2-ylphenoxy)acetyl]amino]-2-methoxyphenyl]thiophene-2-carboxamide |
| SMILES | CCC(C)c1ccc(OCC(=O)Nc2ccc(NC(=O)c3cccs3)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-4-16(2)17-7-10-19(11-8-17)30-15-23(27)25-18-9-12-20(21(14-18)29-3)26-24(28)22-6-5-13-31-22/h5-14,16H,4,15H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | LHCPDRZQNWCNJU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |