C18H20INO2 — CID 1336727
2-[4-[(2R)-butan-2-yl]phenoxy]-N-(4-iodophenyl)acetamide (PubChem CID 1336727) has the molecular formula C18H20INO2 and a molecular weight of 409.27 g/mol. Its IUPAC name is 2-[4-[(2R)-butan-2-yl]phenoxy]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[4-[(2R)-butan-2-yl]phenoxy]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 1336727 |
| Molecular Formula | C18H20INO2 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-[4-[(2R)-butan-2-yl]phenoxy]-N-(4-iodophenyl)acetamide |
| SMILES | CC[C@@H](C)c1ccc(OCC(=O)Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C18H20INO2/c1-3-13(2)14-4-10-17(11-5-14)22-12-18(21)20-16-8-6-15(19)7-9-16/h4-11,13H,3,12H2,1-2H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | KMUJLOHACVYDEU-CYBMUJFWSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|