C26H23NO4 — CID 22776102
2-(4-butan-2-ylphenoxy)-N-(9,10-dioxoanthracen-2-yl)acetamide (PubChem CID 22776102) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenoxy)-N-(9,10-dioxoanthracen-2-yl)acetamide.
| Compound Name | 2-(4-butan-2-ylphenoxy)-N-(9,10-dioxoanthracen-2-yl)acetamide |
|---|---|
| PubChem CID | 22776102 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-(4-butan-2-ylphenoxy)-N-(9,10-dioxoanthracen-2-yl)acetamide |
| SMILES | CCC(C)c1ccc(OCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C26H23NO4/c1-3-16(2)17-8-11-19(12-9-17)31-15-24(28)27-18-10-13-22-23(14-18)26(30)21-7-5-4-6-20(21)25(22)29/h4-14,16H,3,15H2,1-2H3,(H,27,28) |
| InChIKey | ZPKSKKUXDGJEGH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|