C23H16ClNO4 — CID 2892979
2-(4-chloro-3-methylphenoxy)-N-(9,10-dioxoanthracen-2-yl)acetamide (PubChem CID 2892979) has the molecular formula C23H16ClNO4 and a molecular weight of 405.84 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-(9,10-dioxoanthracen-2-yl)acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-(9,10-dioxoanthracen-2-yl)acetamide |
|---|---|
| PubChem CID | 2892979 |
| Molecular Formula | C23H16ClNO4 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-(9,10-dioxoanthracen-2-yl)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)ccc1Cl |
| InChI | InChI=1S/C23H16ClNO4/c1-13-10-15(7-9-20(13)24)29-12-21(26)25-14-6-8-18-19(11-14)23(28)17-5-3-2-4-16(17)22(18)27/h2-11H,12H2,1H3,(H,25,26) |
| InChIKey | XFMCFUVTESZXHP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|