C16H16ClNO4S — CID 18076736
2-(4-chloro-3-methylphenoxy)-N-(4-methylsulfonylphenyl)acetamide (PubChem CID 18076736) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-(4-methylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 18076736 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-(4-methylsulfonylphenyl)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccc(S(C)(=O)=O)cc2)ccc1Cl |
| InChI | InChI=1S/C16H16ClNO4S/c1-11-9-13(5-8-15(11)17)22-10-16(19)18-12-3-6-14(7-4-12)23(2,20)21/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | UPYGPMWORFQEFH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |