C20H19ClN4O5S — CID 54782740
2-(4-chloro-3-methylphenoxy)-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]acetamide (PubChem CID 54782740) has the molecular formula C20H19ClN4O5S and a molecular weight of 462.92 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 54782740 |
| Molecular Formula | C20H19ClN4O5S |
| Molecular Weight | 462.92 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C20H19ClN4O5S/c1-13-11-15(5-8-17(13)21)30-12-18(26)24-14-3-6-16(7-4-14)31(27,28)25-19-20(29-2)23-10-9-22-19/h3-11H,12H2,1-2H3,(H,22,25)(H,24,26) |
| InChIKey | MGVDEUUZGWSGBH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.92 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |