C21H20Cl2N4O4S — CID 25041460
4-(2,4-dichlorophenyl)-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]butanamide (PubChem CID 25041460) has the molecular formula C21H20Cl2N4O4S and a molecular weight of 495.39 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 25041460 |
| Molecular Formula | C21H20Cl2N4O4S |
| Molecular Weight | 495.39 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]butanamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=O)CCCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H20Cl2N4O4S/c1-31-21-20(24-11-12-25-21)27-32(29,30)17-9-7-16(8-10-17)26-19(28)4-2-3-14-5-6-15(22)13-18(14)23/h5-13H,2-4H2,1H3,(H,24,27)(H,26,28) |
| InChIKey | VMIXTQRNCXLJKH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |