C18H15ClN4O4S — CID 22693790
2-chloro-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]benzamide (PubChem CID 22693790) has the molecular formula C18H15ClN4O4S and a molecular weight of 418.86 g/mol. Its IUPAC name is 2-chloro-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 22693790 |
| Molecular Formula | C18H15ClN4O4S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2-chloro-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]benzamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H15ClN4O4S/c1-27-18-16(20-10-11-21-18)23-28(25,26)13-8-6-12(7-9-13)22-17(24)14-4-2-3-5-15(14)19/h2-11H,1H3,(H,20,23)(H,22,24) |
| InChIKey | XUQIHWGZLBKCMU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |