C19H19N5O4S — CID 3424492
1-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]-3-(4-methylphenyl)urea (PubChem CID 3424492) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is 1-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 3424492 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]-3-(4-methylphenyl)urea |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H19N5O4S/c1-13-3-5-14(6-4-13)22-19(25)23-15-7-9-16(10-8-15)29(26,27)24-17-18(28-2)21-12-11-20-17/h3-12H,1-2H3,(H,20,24)(H2,22,23,25) |
| InChIKey | RRIXUZIKUYWBGP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |