C33H36N12O9S3 — CID 170923254
4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide (PubChem CID 170923254) has the molecular formula C33H36N12O9S3 and a molecular weight of 840.93 g/mol. Its IUPAC name is 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 170923254 |
| Molecular Formula | C33H36N12O9S3 |
| Molecular Weight | 840.93 g/mol |
| Exact Mass | 840.19 |
| IUPAC Name | 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(N)cc1.COc1nccnc1NS(=O)(=O)c1ccc(N)cc1.COc1nccnc1NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/3C11H12N4O3S/c3*1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h3*2-7H,12H2,1H3,(H,13,15) |
| InChIKey | QNEZCZGFZKVBLU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 321.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.93 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|