C13H18N4O4S — CID 68855747
4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide;ethanol (PubChem CID 68855747) has the molecular formula C13H18N4O4S and a molecular weight of 326.38 g/mol. Its IUPAC name is 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide;ethanol.
| Compound Name | 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide;ethanol |
|---|---|
| PubChem CID | 68855747 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide;ethanol |
| SMILES | CCO.COc1nccnc1NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H12N4O3S.C2H6O/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9;1-2-3/h2-7H,12H2,1H3,(H,13,15);3H,2H2,1H3 |
| InChIKey | CMLUJHBCBNXLEQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|