C12H13Cl3N4O3S — CID 68857071
4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide;chloroform (PubChem CID 68857071) has the molecular formula C12H13Cl3N4O3S and a molecular weight of 399.69 g/mol. Its IUPAC name is 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide;chloroform.
| Compound Name | 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide;chloroform |
|---|---|
| PubChem CID | 68857071 |
| Molecular Formula | C12H13Cl3N4O3S |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide;chloroform |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(N)cc1.ClC(Cl)Cl |
| InChI | InChI=1S/C11H12N4O3S.CHCl3/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9;2-1(3)4/h2-7H,12H2,1H3,(H,13,15);1H |
| InChIKey | XLMGWQTZXGOIOY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|