C22H23N5O4S2 — CID 54783087
N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-propan-2-ylbenzamide (PubChem CID 54783087) has the molecular formula C22H23N5O4S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 54783087 |
| Molecular Formula | C22H23N5O4S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-propan-2-ylbenzamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H23N5O4S2/c1-14(2)15-4-6-16(7-5-15)20(28)26-22(32)25-17-8-10-18(11-9-17)33(29,30)27-19-21(31-3)24-13-12-23-19/h4-14H,1-3H3,(H,23,27)(H2,25,26,28,32) |
| InChIKey | KOHBTNPDIAFNIJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|