C19H16N6O6S2 — CID 54783138
N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-nitrobenzamide (PubChem CID 54783138) has the molecular formula C19H16N6O6S2 and a molecular weight of 488.51 g/mol. Its IUPAC name is N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-nitrobenzamide.
| Compound Name | N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 54783138 |
| Molecular Formula | C19H16N6O6S2 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-nitrobenzamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H16N6O6S2/c1-31-18-16(20-10-11-21-18)24-33(29,30)15-8-4-13(5-9-15)22-19(32)23-17(26)12-2-6-14(7-3-12)25(27)28/h2-11H,1H3,(H,20,24)(H2,22,23,26,32) |
| InChIKey | PFMOTLKIOHRBJE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 165.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|