C19H15N7O8S2 — CID 54783047
N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-3,5-dinitrobenzamide (PubChem CID 54783047) has the molecular formula C19H15N7O8S2 and a molecular weight of 533.50 g/mol. Its IUPAC name is N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-3,5-dinitrobenzamide.
| Compound Name | N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 54783047 |
| Molecular Formula | C19H15N7O8S2 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.04 |
| IUPAC Name | N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-3,5-dinitrobenzamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2)ncn1 |
| InChI | InChI=1S/C19H15N7O8S2/c1-34-17-9-16(20-10-21-17)24-36(32,33)15-4-2-12(3-5-15)22-19(35)23-18(27)11-6-13(25(28)29)8-14(7-11)26(30)31/h2-10H,1H3,(H,20,21,24)(H2,22,23,27,35) |
| InChIKey | XSKKWBDKAZRQCG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 208.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|