C17H21N5O4S2 — CID 54783055
N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2,2-dimethylpropanamide (PubChem CID 54783055) has the molecular formula C17H21N5O4S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 54783055 |
| Molecular Formula | C17H21N5O4S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2,2-dimethylpropanamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C(C)(C)C)cc2)ncn1 |
| InChI | InChI=1S/C17H21N5O4S2/c1-17(2,3)15(23)21-16(27)20-11-5-7-12(8-6-11)28(24,25)22-13-9-14(26-4)19-10-18-13/h5-10H,1-4H3,(H,18,19,22)(H2,20,21,23,27) |
| InChIKey | WRLJPJVUIRRSFI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|