C24H27N5O5S2 — CID 54783344
N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-4-pentoxybenzamide (PubChem CID 54783344) has the molecular formula C24H27N5O5S2 and a molecular weight of 529.64 g/mol. Its IUPAC name is N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-4-pentoxybenzamide.
| Compound Name | N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 54783344 |
| Molecular Formula | C24H27N5O5S2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3cc(OC)ncn3)cc2)cc1 |
| InChI | InChI=1S/C24H27N5O5S2/c1-3-4-5-14-34-19-10-6-17(7-11-19)23(30)28-24(35)27-18-8-12-20(13-9-18)36(31,32)29-21-15-22(33-2)26-16-25-21/h6-13,15-16H,3-5,14H2,1-2H3,(H,25,26,29)(H2,27,28,30,35) |
| InChIKey | MOPQEWALQOGJTP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|