C23H25N5O5S2 — CID 54783349
4-butoxy-N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 54783349) has the molecular formula C23H25N5O5S2 and a molecular weight of 515.62 g/mol. Its IUPAC name is 4-butoxy-N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 4-butoxy-N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54783349 |
| Molecular Formula | C23H25N5O5S2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 4-butoxy-N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3cc(OC)ncn3)cc2)cc1 |
| InChI | InChI=1S/C23H25N5O5S2/c1-3-4-13-33-18-9-5-16(6-10-18)22(29)27-23(34)26-17-7-11-19(12-8-17)35(30,31)28-20-14-21(32-2)25-15-24-20/h5-12,14-15H,3-4,13H2,1-2H3,(H,24,25,28)(H2,26,27,29,34) |
| InChIKey | KKPHDZRQDANPCL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|