C22H23BrN4O5S — CID 54782897
3-bromo-4-butoxy-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]benzamide (PubChem CID 54782897) has the molecular formula C22H23BrN4O5S and a molecular weight of 535.42 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 3-bromo-4-butoxy-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 54782897 |
| Molecular Formula | C22H23BrN4O5S |
| Molecular Weight | 535.42 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 3-bromo-4-butoxy-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3cc(OC)ncn3)cc2)cc1Br |
| InChI | InChI=1S/C22H23BrN4O5S/c1-3-4-11-32-19-10-5-15(12-18(19)23)22(28)26-16-6-8-17(9-7-16)33(29,30)27-20-13-21(31-2)25-14-24-20/h5-10,12-14H,3-4,11H2,1-2H3,(H,26,28)(H,24,25,27) |
| InChIKey | WIARCAYCPMNKLA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|