C18H16N4O7S — CID 90479890
3,4,5-trihydroxy-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]benzamide (PubChem CID 90479890) has the molecular formula C18H16N4O7S and a molecular weight of 432.41 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 90479890 |
| Molecular Formula | C18H16N4O7S |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 3,4,5-trihydroxy-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]benzamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)c3cc(O)c(O)c(O)c3)cc2)ncn1 |
| InChI | InChI=1S/C18H16N4O7S/c1-29-16-8-15(19-9-20-16)22-30(27,28)12-4-2-11(3-5-12)21-18(26)10-6-13(23)17(25)14(24)7-10/h2-9,23-25H,1H3,(H,21,26)(H,19,20,22) |
| InChIKey | CRARCJKCAHSSKY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 170.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|