C17H18N4O6S — CID 54783018
ethyl (E)-4-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobut-2-enoate (PubChem CID 54783018) has the molecular formula C17H18N4O6S and a molecular weight of 406.42 g/mol. Its IUPAC name is ethyl (E)-4-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 54783018 |
| Molecular Formula | C17H18N4O6S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | ethyl (E)-4-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)Nc1ccc(S(=O)(=O)Nc2cc(OC)ncn2)cc1 |
| InChI | InChI=1S/C17H18N4O6S/c1-3-27-17(23)9-8-15(22)20-12-4-6-13(7-5-12)28(24,25)21-14-10-16(26-2)19-11-18-14/h4-11H,3H2,1-2H3,(H,20,22)(H,18,19,21)/b9-8+ |
| InChIKey | AMIONHSFWDTEOE-CMDGGOBGSA-N |
| XLogP | 1.34 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|