C21H18ClN5O4S2 — CID 54783037
(E)-3-(2-chlorophenyl)-N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 54783037) has the molecular formula C21H18ClN5O4S2 and a molecular weight of 503.99 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 54783037 |
| Molecular Formula | C21H18ClN5O4S2 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)/C=C/c3ccccc3Cl)cc2)ncn1 |
| InChI | InChI=1S/C21H18ClN5O4S2/c1-31-20-12-18(23-13-24-20)27-33(29,30)16-9-7-15(8-10-16)25-21(32)26-19(28)11-6-14-4-2-3-5-17(14)22/h2-13H,1H3,(H,23,24,27)(H2,25,26,28,32)/b11-6+ |
| InChIKey | VSSSZVDYKITNKG-IZZDOVSWSA-N |
| XLogP | 3.47 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|