C20H27N5O4S2 — CID 54783345
N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]octanamide (PubChem CID 54783345) has the molecular formula C20H27N5O4S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]octanamide.
| Compound Name | N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]octanamide |
|---|---|
| PubChem CID | 54783345 |
| Molecular Formula | C20H27N5O4S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]octanamide |
| SMILES | CCCCCCCC(=O)NC(=S)Nc1ccc(S(=O)(=O)Nc2cc(OC)ncn2)cc1 |
| InChI | InChI=1S/C20H27N5O4S2/c1-3-4-5-6-7-8-18(26)24-20(30)23-15-9-11-16(12-10-15)31(27,28)25-17-13-19(29-2)22-14-21-17/h9-14H,3-8H2,1-2H3,(H,21,22,25)(H2,23,24,26,30) |
| InChIKey | WQOSQDLQSDTSMI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|