C23H31N3O3S2 — CID 4958972
N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]octanamide (PubChem CID 4958972) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]octanamide.
| Compound Name | N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]octanamide |
|---|---|
| PubChem CID | 4958972 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]octanamide |
| SMILES | CCCCCCCC(=O)NC(=S)Nc1ccc(S(=O)(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C23H31N3O3S2/c1-4-5-6-7-8-12-21(27)25-23(30)24-19-13-15-20(16-14-19)31(28,29)26-22-17(2)10-9-11-18(22)3/h9-11,13-16,26H,4-8,12H2,1-3H3,(H2,24,25,27,30) |
| InChIKey | OCBZCLKCHOJEPV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|