C22H21N3O3S3 — CID 4934153
N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 4934153) has the molecular formula C22H21N3O3S3 and a molecular weight of 471.63 g/mol. Its IUPAC name is N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4934153 |
| Molecular Formula | C22H21N3O3S3 |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(NC(=S)NC(=O)C=Cc2cccs2)cc1 |
| InChI | InChI=1S/C22H21N3O3S3/c1-15-5-3-6-16(2)21(15)25-31(27,28)19-11-8-17(9-12-19)23-22(29)24-20(26)13-10-18-7-4-14-30-18/h3-14,25H,1-2H3,(H2,23,24,26,29) |
| InChIKey | QSMJRYZQYLEDGY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|