C20H21N3O3S3 — CID 4778448
N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 4778448) has the molecular formula C20H21N3O3S3 and a molecular weight of 447.61 g/mol. Its IUPAC name is N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4778448 |
| Molecular Formula | C20H21N3O3S3 |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=S)NC(=O)C=Cc2cccs2)cc1 |
| InChI | InChI=1S/C20H21N3O3S3/c1-3-13-23(14-4-2)29(25,26)18-10-7-16(8-11-18)21-20(27)22-19(24)12-9-17-6-5-15-28-17/h3-12,15H,1-2,13-14H2,(H2,21,22,24,27) |
| InChIKey | YFNYACGBWPMCSO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|