C17H19N3O3S3 — CID 4924713
N-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 4924713) has the molecular formula C17H19N3O3S3 and a molecular weight of 409.56 g/mol. Its IUPAC name is N-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4924713 |
| Molecular Formula | C17H19N3O3S3 |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=S)NC(=O)C=Cc2cccs2)cc1 |
| InChI | InChI=1S/C17H19N3O3S3/c1-12(2)20-26(22,23)15-8-5-13(6-9-15)18-17(24)19-16(21)10-7-14-4-3-11-25-14/h3-12,20H,1-2H3,(H2,18,19,21,24) |
| InChIKey | DMCBGCOWNJIMLR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|